C29H45N3O3 — CID 142446377
tert-butyl N-cyclohexylcarbamate;1-[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one (PubChem CID 142446377) has the molecular formula C29H45N3O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is tert-butyl N-cyclohexylcarbamate;1-[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one.
| Compound Name | tert-butyl N-cyclohexylcarbamate;1-[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one |
|---|---|
| PubChem CID | 142446377 |
| Molecular Formula | C29H45N3O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | tert-butyl N-cyclohexylcarbamate;1-[1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]propan-1-one |
| SMILES | CC(C)(C)OC(=O)NC1CCCCC1.CCC(=O)N1CCc2c([nH]c3ccccc23)C1CC(C)C |
| InChI | InChI=1S/C18H24N2O.C11H21NO2/c1-4-17(21)20-10-9-14-13-7-5-6-8-15(13)19-18(14)16(20)11-12(2)3;1-11(2,3)14-10(13)12-9-7-5-4-6-8-9/h5-8,12,16,19H,4,9-11H2,1-3H3;9H,4-8H2,1-3H3,(H,12,13) |
| InChIKey | NFGJRTVGXKBMBN-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|