C20H26BrN3O — CID 71558670
1-[(1S)-6-bromo-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(cyclopropylamino)ethanone (PubChem CID 71558670) has the molecular formula C20H26BrN3O and a molecular weight of 404.35 g/mol. Its IUPAC name is 1-[(1S)-6-bromo-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(cyclopropylamino)ethanone.
| Compound Name | 1-[(1S)-6-bromo-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(cyclopropylamino)ethanone |
|---|---|
| PubChem CID | 71558670 |
| Molecular Formula | C20H26BrN3O |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | 1-[(1S)-6-bromo-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(cyclopropylamino)ethanone |
| SMILES | CC(C)C[C@H]1c2[nH]c3ccc(Br)cc3c2CCN1C(=O)CNC1CC1 |
| InChI | InChI=1S/C20H26BrN3O/c1-12(2)9-18-20-15(16-10-13(21)3-6-17(16)23-20)7-8-24(18)19(25)11-22-14-4-5-14/h3,6,10,12,14,18,22-23H,4-5,7-9,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | UIBQFOYELUTVKQ-SFHVURJKSA-N |
| XLogP | 4.15 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|