C21H25ClN4O2 — CID 71558668
1-[6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1,2-oxazol-5-ylmethylamino)ethanone (PubChem CID 71558668) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is 1-[6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1,2-oxazol-5-ylmethylamino)ethanone.
| Compound Name | 1-[6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1,2-oxazol-5-ylmethylamino)ethanone |
|---|---|
| PubChem CID | 71558668 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 1-[6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1,2-oxazol-5-ylmethylamino)ethanone |
| SMILES | CC(C)CC1c2[nH]c3ccc(Cl)cc3c2CCN1C(=O)CNCc1ccno1 |
| InChI | InChI=1S/C21H25ClN4O2/c1-13(2)9-19-21-16(17-10-14(22)3-4-18(17)25-21)6-8-26(19)20(27)12-23-11-15-5-7-24-28-15/h3-5,7,10,13,19,23,25H,6,8-9,11-12H2,1-2H3 |
| InChIKey | FNUOSJOFGHNKJA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|