C22H28ClF2N3O — CID 71557229
1-[6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(4,4-difluoropiperidin-1-yl)ethanone (PubChem CID 71557229) has the molecular formula C22H28ClF2N3O and a molecular weight of 423.94 g/mol. Its IUPAC name is 1-[6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(4,4-difluoropiperidin-1-yl)ethanone.
| Compound Name | 1-[6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(4,4-difluoropiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 71557229 |
| Molecular Formula | C22H28ClF2N3O |
| Molecular Weight | 423.94 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 1-[6-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(4,4-difluoropiperidin-1-yl)ethanone |
| SMILES | CC(C)CC1c2[nH]c3ccc(Cl)cc3c2CCN1C(=O)CN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C22H28ClF2N3O/c1-14(2)11-19-21-16(17-12-15(23)3-4-18(17)26-21)5-8-28(19)20(29)13-27-9-6-22(24,25)7-10-27/h3-4,12,14,19,26H,5-11,13H2,1-2H3 |
| InChIKey | QEADWSWHDUZNAY-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.94 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|