C22H30ClN3O3 — CID 126738700
tert-butyl N-[2-[7-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]carbamate (PubChem CID 126738700) has the molecular formula C22H30ClN3O3 and a molecular weight of 419.95 g/mol. Its IUPAC name is tert-butyl N-[2-[7-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[7-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 126738700 |
| Molecular Formula | C22H30ClN3O3 |
| Molecular Weight | 419.95 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | tert-butyl N-[2-[7-chloro-1-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-oxoethyl]carbamate |
| SMILES | CC(C)CC1c2[nH]c3cc(Cl)ccc3c2CCN1C(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30ClN3O3/c1-13(2)10-18-20-16(15-7-6-14(23)11-17(15)25-20)8-9-26(18)19(27)12-24-21(28)29-22(3,4)5/h6-7,11,13,18,25H,8-10,12H2,1-5H3,(H,24,28) |
| InChIKey | DHJOWSUQSIZYED-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.95 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|