C16H19BrN2O2 — CID 138731268
propan-2-yl 6-bromo-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 138731268) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is propan-2-yl 6-bromo-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | propan-2-yl 6-bromo-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 138731268 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | propan-2-yl 6-bromo-1-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CC(C)OC(=O)N1CCc2c([nH]c3ccc(Br)cc23)C1C |
| InChI | InChI=1S/C16H19BrN2O2/c1-9(2)21-16(20)19-7-6-12-13-8-11(17)4-5-14(13)18-15(12)10(19)3/h4-5,8-10,18H,6-7H2,1-3H3 |
| InChIKey | MSQIBRYMUUUAAJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|