C24H27BrN2OS2 — CID 59421552
3-methylbutyl 6-bromo-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate (PubChem CID 59421552) has the molecular formula C24H27BrN2OS2 and a molecular weight of 503.53 g/mol. Its IUPAC name is 3-methylbutyl 6-bromo-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate.
| Compound Name | 3-methylbutyl 6-bromo-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate |
|---|---|
| PubChem CID | 59421552 |
| Molecular Formula | C24H27BrN2OS2 |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 502.07 |
| IUPAC Name | 3-methylbutyl 6-bromo-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbodithioate |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Br)cc4c3CCN2C(=S)SCCC(C)C)cc1 |
| InChI | InChI=1S/C24H27BrN2OS2/c1-15(2)11-13-30-24(29)27-12-10-19-20-14-17(25)6-9-21(20)26-22(19)23(27)16-4-7-18(28-3)8-5-16/h4-9,14-15,23,26H,10-13H2,1-3H3 |
| InChIKey | GQLQAWJIXFFKOK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|