C20H25N3O3 — CID 101025876
tert-butyl N-[(1S,12bR)-4-oxo-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-1-yl]carbamate (PubChem CID 101025876) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is tert-butyl N-[(1S,12bR)-4-oxo-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,12bR)-4-oxo-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-1-yl]carbamate |
|---|---|
| PubChem CID | 101025876 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | tert-butyl N-[(1S,12bR)-4-oxo-2,3,6,7,12,12b-hexahydro-1H-indolo[2,3-a]quinolizin-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC(=O)N2CCc3c([nH]c4ccccc34)[C@@H]12 |
| InChI | InChI=1S/C20H25N3O3/c1-20(2,3)26-19(25)22-15-8-9-16(24)23-11-10-13-12-6-4-5-7-14(12)21-17(13)18(15)23/h4-7,15,18,21H,8-11H2,1-3H3,(H,22,25)/t15-,18+/m0/s1 |
| InChIKey | YRLWIKKTXCGTPW-MAUKXSAKSA-N |
| XLogP | 3.28 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|