C25H34N2O5S — CID 11488344
tert-butyl (1R,3R,4S)-1-acetyl-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5,10-tetrahydrothiepino[3,4-b]indole-1-carboxylate (PubChem CID 11488344) has the molecular formula C25H34N2O5S and a molecular weight of 474.62 g/mol. Its IUPAC name is tert-butyl (1R,3R,4S)-1-acetyl-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5,10-tetrahydrothiepino[3,4-b]indole-1-carboxylate.
| Compound Name | tert-butyl (1R,3R,4S)-1-acetyl-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5,10-tetrahydrothiepino[3,4-b]indole-1-carboxylate |
|---|---|
| PubChem CID | 11488344 |
| Molecular Formula | C25H34N2O5S |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | tert-butyl (1R,3R,4S)-1-acetyl-3-methyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5,10-tetrahydrothiepino[3,4-b]indole-1-carboxylate |
| SMILES | CC(=O)[C@]1(C(=O)OC(C)(C)C)S[C@H](C)[C@@H](NC(=O)OC(C)(C)C)Cc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C25H34N2O5S/c1-14-19(27-22(30)32-24(6,7)8)13-17-16-11-9-10-12-18(16)26-20(17)25(33-14,15(2)28)21(29)31-23(3,4)5/h9-12,14,19,26H,13H2,1-8H3,(H,27,30)/t14-,19+,25+/m1/s1 |
| InChIKey | UMVSWHFUNZQMSL-XZLBEJRYSA-N |
| XLogP | 4.86 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|