C20H24N4O4 — CID 3820638
tert-butyl N-(2-methyl-3,6-dioxo-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraen-4-yl)carbamate (PubChem CID 3820638) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is tert-butyl N-(2-methyl-3,6-dioxo-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraen-4-yl)carbamate.
| Compound Name | tert-butyl N-(2-methyl-3,6-dioxo-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraen-4-yl)carbamate |
|---|---|
| PubChem CID | 3820638 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | tert-butyl N-(2-methyl-3,6-dioxo-4,7,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),11,13,15-tetraen-4-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NN1CC(=O)N2CCc3c([nH]c4ccccc34)C2(C)C1=O |
| InChI | InChI=1S/C20H24N4O4/c1-19(2,3)28-18(27)22-24-11-15(25)23-10-9-13-12-7-5-6-8-14(12)21-16(13)20(23,4)17(24)26/h5-8,21H,9-11H2,1-4H3,(H,22,27) |
| InChIKey | VZSKKFKGLWNIFC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |