C17H23N3O2 — CID 107236657
tert-butyl N-(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)carbamate (PubChem CID 107236657) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is tert-butyl N-(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)carbamate.
| Compound Name | tert-butyl N-(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)carbamate |
|---|---|
| PubChem CID | 107236657 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | tert-butyl N-(2,3,4,9-tetrahydro-1H-carbazol-1-ylamino)carbamate |
| SMILES | CC(C)(C)OC(=O)NNC1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C17H23N3O2/c1-17(2,3)22-16(21)20-19-14-10-6-8-12-11-7-4-5-9-13(11)18-15(12)14/h4-5,7,9,14,18-19H,6,8,10H2,1-3H3,(H,20,21) |
| InChIKey | XGDDVSJIUWDXBT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|