C22H24N2O2 — CID 153378658
tert-butyl N-[(2S)-2-(1H-indol-3-yl)-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 153378658) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-(1H-indol-3-yl)-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-(1H-indol-3-yl)-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 153378658 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | tert-butyl N-[(2S)-2-(1H-indol-3-yl)-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1c2ccccc2C[C@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H24N2O2/c1-22(2,3)26-21(25)24-20-15-9-5-4-8-14(15)12-17(20)18-13-23-19-11-7-6-10-16(18)19/h4-11,13,17,20,23H,12H2,1-3H3,(H,24,25)/t17-,20?/m0/s1 |
| InChIKey | ZAAJZKJFFQVEOW-DIMJTDRSSA-N |
| XLogP | 5.07 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |