C19H26N2O2 — CID 3468630
tert-butyl N-[2-(5-methyl-1H-indol-3-yl)cyclopentyl]carbamate (PubChem CID 3468630) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl N-[2-(5-methyl-1H-indol-3-yl)cyclopentyl]carbamate.
| Compound Name | tert-butyl N-[2-(5-methyl-1H-indol-3-yl)cyclopentyl]carbamate |
|---|---|
| PubChem CID | 3468630 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | tert-butyl N-[2-(5-methyl-1H-indol-3-yl)cyclopentyl]carbamate |
| SMILES | Cc1ccc2[nH]cc(C3CCCC3NC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C19H26N2O2/c1-12-8-9-16-14(10-12)15(11-20-16)13-6-5-7-17(13)21-18(22)23-19(2,3)4/h8-11,13,17,20H,5-7H2,1-4H3,(H,21,22) |
| InChIKey | LHFRWIMZPXQPGJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |