C20H26N2O2 — CID 126553219
(2S)-N-[(1R,3S)-3-(5-methyl-1H-indol-3-yl)cyclohexyl]oxolane-2-carboxamide (PubChem CID 126553219) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is (2S)-N-[(1R,3S)-3-(5-methyl-1H-indol-3-yl)cyclohexyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[(1R,3S)-3-(5-methyl-1H-indol-3-yl)cyclohexyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 126553219 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2S)-N-[(1R,3S)-3-(5-methyl-1H-indol-3-yl)cyclohexyl]oxolane-2-carboxamide |
| SMILES | Cc1ccc2[nH]cc([C@H]3CCC[C@@H](NC(=O)[C@@H]4CCCO4)C3)c2c1 |
| InChI | InChI=1S/C20H26N2O2/c1-13-7-8-18-16(10-13)17(12-21-18)14-4-2-5-15(11-14)22-20(23)19-6-3-9-24-19/h7-8,10,12,14-15,19,21H,2-6,9,11H2,1H3,(H,22,23)/t14-,15+,19-/m0/s1 |
| InChIKey | RUYMJUZCRSSCEJ-KHYOSLBOSA-N |
| XLogP | 3.80 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |