C24H34N2O4 — CID 126553136
(2S)-N-[(1S,3R)-3-(6-butoxy-5-methoxy-1H-indol-3-yl)cyclohexyl]oxolane-2-carboxamide (PubChem CID 126553136) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is (2S)-N-[(1S,3R)-3-(6-butoxy-5-methoxy-1H-indol-3-yl)cyclohexyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[(1S,3R)-3-(6-butoxy-5-methoxy-1H-indol-3-yl)cyclohexyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 126553136 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | (2S)-N-[(1S,3R)-3-(6-butoxy-5-methoxy-1H-indol-3-yl)cyclohexyl]oxolane-2-carboxamide |
| SMILES | CCCCOc1cc2[nH]cc([C@@H]3CCC[C@H](NC(=O)[C@@H]4CCCO4)C3)c2cc1OC |
| InChI | InChI=1S/C24H34N2O4/c1-3-4-10-30-23-14-20-18(13-22(23)28-2)19(15-25-20)16-7-5-8-17(12-16)26-24(27)21-9-6-11-29-21/h13-17,21,25H,3-12H2,1-2H3,(H,26,27)/t16-,17+,21+/m1/s1 |
| InChIKey | JPYLICQADSXVKJ-WWMYMODYSA-N |
| XLogP | 4.68 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|