C22H33N3O5 — CID 145244112
cyclohexane;2-[(5-methoxy-1H-indol-6-yl)oxy]acetamide;(2S)-oxolane-2-carboxamide (PubChem CID 145244112) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is cyclohexane;2-[(5-methoxy-1H-indol-6-yl)oxy]acetamide;(2S)-oxolane-2-carboxamide.
| Compound Name | cyclohexane;2-[(5-methoxy-1H-indol-6-yl)oxy]acetamide;(2S)-oxolane-2-carboxamide |
|---|---|
| PubChem CID | 145244112 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | cyclohexane;2-[(5-methoxy-1H-indol-6-yl)oxy]acetamide;(2S)-oxolane-2-carboxamide |
| SMILES | C1CCCCC1.COc1cc2cc[nH]c2cc1OCC(N)=O.NC(=O)[C@@H]1CCCO1 |
| InChI | InChI=1S/C11H12N2O3.C6H12.C5H9NO2/c1-15-9-4-7-2-3-13-8(7)5-10(9)16-6-11(12)14;1-2-4-6-5-3-1;6-5(7)4-2-1-3-8-4/h2-5,13H,6H2,1H3,(H2,12,14);1-6H2;4H,1-3H2,(H2,6,7)/t;;4-/m..0/s1 |
| InChIKey | OYYPIPXJBNTTTJ-MCIOAOFGSA-N |
| XLogP | 3.03 |
| TPSA | 129.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |