About cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide
cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide (PubChem CID 145244161) has the molecular formula C22H32N2O2
and a molecular weight of 356.51 g/mol. Its IUPAC name is cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide.
Molecular Properties
| Compound Name | cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide |
| PubChem CID | 145244161 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide |
| SMILES | C1CCCCC1.NC(=O)[C@@H]1CCCO1.c1cc2cc(C3CC3)ccc2[nH]1 |
| InChI | InChI=1S/C11H11N.C6H12.C5H9NO2/c1-2-8(1)9-3-4-11-10(7-9)5-6-12-11;1-2-4-6-5-3-1;6-5(7)4-2-1-3-8-4/h3-8,12H,1-2H2;1-6H2;4H,1-3H2,(H2,6,7)/t;;4-/m..0/s1 |
| InChIKey | LNWHQFRTENLDFH-MCIOAOFGSA-N |
| XLogP | 5.04 |
| TPSA | 68.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide?
The IUPAC name of cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide (CID 145244161) is cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide.
What is the SMILES notation for cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide?
The canonical SMILES for cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide is C1CCCCC1.NC(=O)[C@@H]1CCCO1.c1cc2cc(C3CC3)ccc2[nH]1.
What is the InChIKey of cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide?
The InChIKey is LNWHQFRTENLDFH-MCIOAOFGSA-N. The full InChI is InChI=1S/C11H11N.C6H12.C5H9NO2/c1-2-8(1)9-3-4-11-10(7-9)5-6-12-11;1-2-4-6-5-3-1;6-5(7)4-2-1-3-8-4/h3-8,12H,1-2H2;1-6H2;4H,1-3H2,(H2,6,7)/t;;4-/m..0/s1.
What are the key properties of cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide?
cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide has a molecular weight of 356.51 g/mol, XLogP of 5.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;5-cyclopropyl-1H-indole;(2S)-oxolane-2-carboxamide is sourced from PubChem (CID 145244161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).