About 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide
5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide (PubChem CID 145244067) has the molecular formula C17H24ClN3O2
and a molecular weight of 337.85 g/mol. Its IUPAC name is 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide |
| PubChem CID | 145244067 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide |
| SMILES | C1CCCC1.Clc1ccc2[nH]ncc2c1.NC(=O)[C@@H]1CCCO1 |
| InChI | InChI=1S/C7H5ClN2.C5H9NO2.C5H10/c8-6-1-2-7-5(3-6)4-9-10-7;6-5(7)4-2-1-3-8-4;1-2-4-5-3-1/h1-4H,(H,9,10);4H,1-3H2,(H2,6,7);1-5H2/t;4-;/m.0./s1 |
| InChIKey | MFWHMXHVEWEOCG-INZIHYEWSA-N |
| XLogP | 3.82 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide?
The IUPAC name of 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide (CID 145244067) is 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide.
What is the SMILES notation for 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide?
The canonical SMILES for 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide is C1CCCC1.Clc1ccc2[nH]ncc2c1.NC(=O)[C@@H]1CCCO1.
What is the InChIKey of 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide?
The InChIKey is MFWHMXHVEWEOCG-INZIHYEWSA-N. The full InChI is InChI=1S/C7H5ClN2.C5H9NO2.C5H10/c8-6-1-2-7-5(3-6)4-9-10-7;6-5(7)4-2-1-3-8-4;1-2-4-5-3-1/h1-4H,(H,9,10);4H,1-3H2,(H2,6,7);1-5H2/t;4-;/m.0./s1.
What are the key properties of 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide?
5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide has a molecular weight of 337.85 g/mol, XLogP of 3.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide is sourced from PubChem (CID 145244067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).