C17H24ClN3O2 — CID 145244067
5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide (PubChem CID 145244067) has the molecular formula C17H24ClN3O2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide.
| Compound Name | 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide |
|---|---|
| PubChem CID | 145244067 |
| Molecular Formula | C17H24ClN3O2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 5-chloro-1H-indazole;cyclopentane;(2S)-oxolane-2-carboxamide |
| SMILES | C1CCCC1.Clc1ccc2[nH]ncc2c1.NC(=O)[C@@H]1CCCO1 |
| InChI | InChI=1S/C7H5ClN2.C5H9NO2.C5H10/c8-6-1-2-7-5(3-6)4-9-10-7;6-5(7)4-2-1-3-8-4;1-2-4-5-3-1/h1-4H,(H,9,10);4H,1-3H2,(H2,6,7);1-5H2/t;4-;/m.0./s1 |
| InChIKey | MFWHMXHVEWEOCG-INZIHYEWSA-N |
| XLogP | 3.82 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |