C12H14ClN2O3+ — CID 3517058
[amino-(4-chlorophenyl)methylidene]-(oxolane-2-carbonyloxy)azanium (PubChem CID 3517058) has the molecular formula C12H14ClN2O3+ and a molecular weight of 269.71 g/mol. Its IUPAC name is [amino-(4-chlorophenyl)methylidene]-(oxolane-2-carbonyloxy)azanium.
| Compound Name | [amino-(4-chlorophenyl)methylidene]-(oxolane-2-carbonyloxy)azanium |
|---|---|
| PubChem CID | 3517058 |
| Molecular Formula | C12H14ClN2O3+ |
| Molecular Weight | 269.71 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | [amino-(4-chlorophenyl)methylidene]-(oxolane-2-carbonyloxy)azanium |
| SMILES | NC(=[NH+]OC(=O)C1CCCO1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2O3/c13-9-5-3-8(4-6-9)11(14)15-18-12(16)10-2-1-7-17-10/h3-6,10H,1-2,7H2,(H2,14,15)/p+1 |
| InChIKey | VADNRRLJOYAYNX-UHFFFAOYSA-O |
| XLogP | -0.24 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.71 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|