About (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate
(4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate (PubChem CID 174440245) has the molecular formula C12H12O4S
and a molecular weight of 252.29 g/mol. Its IUPAC name is (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate.
Molecular Properties
| Compound Name | (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate |
| PubChem CID | 174440245 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate |
| SMILES | O=C(OC(=O)[C@H]1CCCO1)c1ccc(S)cc1 |
| InChI | InChI=1S/C12H12O4S/c13-11(8-3-5-9(17)6-4-8)16-12(14)10-2-1-7-15-10/h3-6,10,17H,1-2,7H2/t10-/m1/s1 |
| InChIKey | RQYSIIDPMKURRK-SNVBAGLBSA-N |
| XLogP | 1.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate?
The IUPAC name of (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate (CID 174440245) is (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate.
What is the SMILES notation for (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate?
The canonical SMILES for (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate is O=C(OC(=O)[C@H]1CCCO1)c1ccc(S)cc1.
What is the InChIKey of (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate?
The InChIKey is RQYSIIDPMKURRK-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H12O4S/c13-11(8-3-5-9(17)6-4-8)16-12(14)10-2-1-7-15-10/h3-6,10,17H,1-2,7H2/t10-/m1/s1.
What are the key properties of (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate?
(4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate has a molecular weight of 252.29 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-sulfanylbenzoyl) (2R)-oxolane-2-carboxylate is sourced from PubChem (CID 174440245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).