C25H21ClN2 — CID 141376003
5-[(E)-2-(4-chloro-2-methylphenyl)-2-cyclopropyl-1-phenylethenyl]-1H-indazole (PubChem CID 141376003) has the molecular formula C25H21ClN2 and a molecular weight of 384.91 g/mol. Its IUPAC name is 5-[(E)-2-(4-chloro-2-methylphenyl)-2-cyclopropyl-1-phenylethenyl]-1H-indazole.
| Compound Name | 5-[(E)-2-(4-chloro-2-methylphenyl)-2-cyclopropyl-1-phenylethenyl]-1H-indazole |
|---|---|
| PubChem CID | 141376003 |
| Molecular Formula | C25H21ClN2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 5-[(E)-2-(4-chloro-2-methylphenyl)-2-cyclopropyl-1-phenylethenyl]-1H-indazole |
| SMILES | Cc1cc(Cl)ccc1/C(=C(\c1ccccc1)c1ccc2[nH]ncc2c1)C1CC1 |
| InChI | InChI=1S/C25H21ClN2/c1-16-13-21(26)10-11-22(16)25(18-7-8-18)24(17-5-3-2-4-6-17)19-9-12-23-20(14-19)15-27-28-23/h2-6,9-15,18H,7-8H2,1H3,(H,27,28)/b25-24+ |
| InChIKey | KLUMFPOZUNARRN-OCOZRVBESA-N |
| XLogP | 6.89 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|