C22H32N2O3 — CID 126553064
(2R)-N-[(1R,3S)-3-(5-methoxy-2-methyl-2,3-dihydro-1H-indol-3-yl)cyclohexyl]oxane-2-carboxamide (PubChem CID 126553064) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is (2R)-N-[(1R,3S)-3-(5-methoxy-2-methyl-2,3-dihydro-1H-indol-3-yl)cyclohexyl]oxane-2-carboxamide.
| Compound Name | (2R)-N-[(1R,3S)-3-(5-methoxy-2-methyl-2,3-dihydro-1H-indol-3-yl)cyclohexyl]oxane-2-carboxamide |
|---|---|
| PubChem CID | 126553064 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | (2R)-N-[(1R,3S)-3-(5-methoxy-2-methyl-2,3-dihydro-1H-indol-3-yl)cyclohexyl]oxane-2-carboxamide |
| SMILES | COc1ccc2c(c1)C([C@H]1CCC[C@@H](NC(=O)[C@H]3CCCCO3)C1)C(C)N2 |
| InChI | InChI=1S/C22H32N2O3/c1-14-21(18-13-17(26-2)9-10-19(18)23-14)15-6-5-7-16(12-15)24-22(25)20-8-3-4-11-27-20/h9-10,13-16,20-21,23H,3-8,11-12H2,1-2H3,(H,24,25)/t14?,15-,16+,20+,21?/m0/s1 |
| InChIKey | NOPJLTNHVRBASF-NFFDTRNLSA-N |
| XLogP | 3.84 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|