C13H17NO4 — CID 9096652
(2S)-N-(3,5-dimethoxyphenyl)oxolane-2-carboxamide (PubChem CID 9096652) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (2S)-N-(3,5-dimethoxyphenyl)oxolane-2-carboxamide.
| Compound Name | (2S)-N-(3,5-dimethoxyphenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 9096652 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2S)-N-(3,5-dimethoxyphenyl)oxolane-2-carboxamide |
| SMILES | COc1cc(NC(=O)[C@@H]2CCCO2)cc(OC)c1 |
| InChI | InChI=1S/C13H17NO4/c1-16-10-6-9(7-11(8-10)17-2)14-13(15)12-4-3-5-18-12/h6-8,12H,3-5H2,1-2H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | GLRFTAPWJCPHIE-LBPRGKRZSA-N |
| XLogP | 1.82 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |