C11H11Br2NO3 — CID 9319932
(2S)-N-(3,5-dibromo-4-hydroxyphenyl)oxolane-2-carboxamide (PubChem CID 9319932) has the molecular formula C11H11Br2NO3 and a molecular weight of 365.02 g/mol. Its IUPAC name is (2S)-N-(3,5-dibromo-4-hydroxyphenyl)oxolane-2-carboxamide.
| Compound Name | (2S)-N-(3,5-dibromo-4-hydroxyphenyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 9319932 |
| Molecular Formula | C11H11Br2NO3 |
| Molecular Weight | 365.02 g/mol |
| Exact Mass | 362.91 |
| IUPAC Name | (2S)-N-(3,5-dibromo-4-hydroxyphenyl)oxolane-2-carboxamide |
| SMILES | O=C(Nc1cc(Br)c(O)c(Br)c1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C11H11Br2NO3/c12-7-4-6(5-8(13)10(7)15)14-11(16)9-2-1-3-17-9/h4-5,9,15H,1-3H2,(H,14,16)/t9-/m0/s1 |
| InChIKey | VYPGCBYBVYFFFV-VIFPVBQESA-N |
| XLogP | 3.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.02 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|