C20H22N2O5 — CID 51936894
(2S)-N-[4-[(2,4-dimethoxybenzoyl)amino]phenyl]oxolane-2-carboxamide (PubChem CID 51936894) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is (2S)-N-[4-[(2,4-dimethoxybenzoyl)amino]phenyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[4-[(2,4-dimethoxybenzoyl)amino]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 51936894 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (2S)-N-[4-[(2,4-dimethoxybenzoyl)amino]phenyl]oxolane-2-carboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(NC(=O)[C@@H]3CCCO3)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H22N2O5/c1-25-15-9-10-16(18(12-15)26-2)19(23)21-13-5-7-14(8-6-13)22-20(24)17-4-3-11-27-17/h5-10,12,17H,3-4,11H2,1-2H3,(H,21,23)(H,22,24)/t17-/m0/s1 |
| InChIKey | MHSCPKWRJSQRKH-KRWDZBQOSA-N |
| XLogP | 3.07 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |