C11H15NO — CID 71486083
(2S,3S)-5-methoxy-2,3-dimethyl-2,3-dihydro-1H-indole (PubChem CID 71486083) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (2S,3S)-5-methoxy-2,3-dimethyl-2,3-dihydro-1H-indole.
| Compound Name | (2S,3S)-5-methoxy-2,3-dimethyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 71486083 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (2S,3S)-5-methoxy-2,3-dimethyl-2,3-dihydro-1H-indole |
| SMILES | COc1ccc2c(c1)[C@H](C)[C@H](C)N2 |
| InChI | InChI=1S/C11H15NO/c1-7-8(2)12-11-5-4-9(13-3)6-10(7)11/h4-8,12H,1-3H3/t7-,8+/m1/s1 |
| InChIKey | NFVOUDOZYBZNOX-SFYZADRCSA-N |
| XLogP | 2.61 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|