C8H11N3O — CID 86340464
5-methoxy-2,3-dihydro-1H-benzimidazol-2-amine (PubChem CID 86340464) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 5-methoxy-2,3-dihydro-1H-benzimidazol-2-amine.
| Compound Name | 5-methoxy-2,3-dihydro-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 86340464 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 5-methoxy-2,3-dihydro-1H-benzimidazol-2-amine |
| SMILES | COc1ccc2c(c1)NC(N)N2 |
| InChI | InChI=1S/C8H11N3O/c1-12-5-2-3-6-7(4-5)11-8(9)10-6/h2-4,8,10-11H,9H2,1H3 |
| InChIKey | XLHFHVANZPHZLK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|