C13H17NO — CID 101449816
(3aS,8bS)-7-methoxy-3a-methyl-2,3,4,8b-tetrahydro-1H-cyclopenta[b]indole (PubChem CID 101449816) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is (3aS,8bS)-7-methoxy-3a-methyl-2,3,4,8b-tetrahydro-1H-cyclopenta[b]indole.
| Compound Name | (3aS,8bS)-7-methoxy-3a-methyl-2,3,4,8b-tetrahydro-1H-cyclopenta[b]indole |
|---|---|
| PubChem CID | 101449816 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (3aS,8bS)-7-methoxy-3a-methyl-2,3,4,8b-tetrahydro-1H-cyclopenta[b]indole |
| SMILES | COc1ccc2c(c1)[C@@H]1CCC[C@]1(C)N2 |
| InChI | InChI=1S/C13H17NO/c1-13-7-3-4-11(13)10-8-9(15-2)5-6-12(10)14-13/h5-6,8,11,14H,3-4,7H2,1-2H3/t11-,13-/m0/s1 |
| InChIKey | PPGUKPUEWCZMJE-AAEUAGOBSA-N |
| XLogP | 3.15 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|