C15H22O3Si — CID 122373274
(7-methoxy-1,2,3,8b-tetrahydrocyclopenta[b][1]benzofuran-3a-yl)oxy-trimethylsilane (PubChem CID 122373274) has the molecular formula C15H22O3Si and a molecular weight of 278.42 g/mol. Its IUPAC name is (7-methoxy-1,2,3,8b-tetrahydrocyclopenta[b][1]benzofuran-3a-yl)oxy-trimethylsilane.
| Compound Name | (7-methoxy-1,2,3,8b-tetrahydrocyclopenta[b][1]benzofuran-3a-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 122373274 |
| Molecular Formula | C15H22O3Si |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (7-methoxy-1,2,3,8b-tetrahydrocyclopenta[b][1]benzofuran-3a-yl)oxy-trimethylsilane |
| SMILES | COc1ccc2c(c1)C1CCCC1(O[Si](C)(C)C)O2 |
| InChI | InChI=1S/C15H22O3Si/c1-16-11-7-8-14-12(10-11)13-6-5-9-15(13,17-14)18-19(2,3)4/h7-8,10,13H,5-6,9H2,1-4H3 |
| InChIKey | AWBQEBOFLTZRHW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|