C15H20O3 — CID 104950862
(4S)-6-methoxyspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol (PubChem CID 104950862) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (4S)-6-methoxyspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol.
| Compound Name | (4S)-6-methoxyspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
|---|---|
| PubChem CID | 104950862 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (4S)-6-methoxyspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
| SMILES | COc1ccc2c(c1)[C@@H](O)CC1(CCCCC1)O2 |
| InChI | InChI=1S/C15H20O3/c1-17-11-5-6-14-12(9-11)13(16)10-15(18-14)7-3-2-4-8-15/h5-6,9,13,16H,2-4,7-8,10H2,1H3/t13-/m0/s1 |
| InChIKey | OERVVLDEYYSDMT-ZDUSSCGKSA-N |
| XLogP | 3.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |