C16H23NO3 — CID 114715390
6-methoxy-1'-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol (PubChem CID 114715390) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 6-methoxy-1'-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol.
| Compound Name | 6-methoxy-1'-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol |
|---|---|
| PubChem CID | 114715390 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 6-methoxy-1'-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol |
| SMILES | COc1ccc2c(c1)C(O)CC1(CCCN(C)CC1)O2 |
| InChI | InChI=1S/C16H23NO3/c1-17-8-3-6-16(7-9-17)11-14(18)13-10-12(19-2)4-5-15(13)20-16/h4-5,10,14,18H,3,6-9,11H2,1-2H3 |
| InChIKey | MBCKRXGDOZAPHJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |