C15H20ClNO2 — CID 104948992
(4S)-6-chloro-1'-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol (PubChem CID 104948992) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is (4S)-6-chloro-1'-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol.
| Compound Name | (4S)-6-chloro-1'-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol |
|---|---|
| PubChem CID | 104948992 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (4S)-6-chloro-1'-methylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol |
| SMILES | CN1CCCC2(CC1)C[C@H](O)c1cc(Cl)ccc1O2 |
| InChI | InChI=1S/C15H20ClNO2/c1-17-7-2-5-15(6-8-17)10-13(18)12-9-11(16)3-4-14(12)19-15/h3-4,9,13,18H,2,5-8,10H2,1H3/t13-,15?/m0/s1 |
| InChIKey | LHXMWUFBABLFOU-CFMCSPIPSA-N |
| XLogP | 3.01 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |