C17H24ClNO2 — CID 104948996
(4S)-6-chloro-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol (PubChem CID 104948996) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is (4S)-6-chloro-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol.
| Compound Name | (4S)-6-chloro-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol |
|---|---|
| PubChem CID | 104948996 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (4S)-6-chloro-1'-propylspiro[3,4-dihydrochromene-2,4'-azepane]-4-ol |
| SMILES | CCCN1CCCC2(CC1)C[C@H](O)c1cc(Cl)ccc1O2 |
| InChI | InChI=1S/C17H24ClNO2/c1-2-8-19-9-3-6-17(7-10-19)12-15(20)14-11-13(18)4-5-16(14)21-17/h4-5,11,15,20H,2-3,6-10,12H2,1H3/t15-,17?/m0/s1 |
| InChIKey | UFXWTVZRDRMELN-MYJWUSKBSA-N |
| XLogP | 3.79 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |