C15H19ClO2 — CID 104949252
(4R)-6-chlorospiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol (PubChem CID 104949252) has the molecular formula C15H19ClO2 and a molecular weight of 266.77 g/mol. Its IUPAC name is (4R)-6-chlorospiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol.
| Compound Name | (4R)-6-chlorospiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol |
|---|---|
| PubChem CID | 104949252 |
| Molecular Formula | C15H19ClO2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (4R)-6-chlorospiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol |
| SMILES | O[C@@H]1CC2(CCCCCC2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H19ClO2/c16-11-5-6-14-12(9-11)13(17)10-15(18-14)7-3-1-2-4-8-15/h5-6,9,13,17H,1-4,7-8,10H2/t13-/m1/s1 |
| InChIKey | MRWPGRUCLDNNLT-CYBMUJFWSA-N |
| XLogP | 4.25 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |