C16H21FO2 — CID 104948441
(4R)-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclooctane]-4-ol (PubChem CID 104948441) has the molecular formula C16H21FO2 and a molecular weight of 264.34 g/mol. Its IUPAC name is (4R)-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclooctane]-4-ol.
| Compound Name | (4R)-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclooctane]-4-ol |
|---|---|
| PubChem CID | 104948441 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (4R)-6-fluorospiro[3,4-dihydrochromene-2,1'-cyclooctane]-4-ol |
| SMILES | O[C@@H]1CC2(CCCCCCC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C16H21FO2/c17-12-6-7-15-13(10-12)14(18)11-16(19-15)8-4-2-1-3-5-9-16/h6-7,10,14,18H,1-5,8-9,11H2/t14-/m1/s1 |
| InChIKey | MLIQXHCWPVWAML-CQSZACIVSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |