C14H18O2 — CID 104949961
(4S)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol (PubChem CID 104949961) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (4S)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol.
| Compound Name | (4S)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
|---|---|
| PubChem CID | 104949961 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (4S)-spiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-ol |
| SMILES | O[C@H]1CC2(CCCCC2)Oc2ccccc21 |
| InChI | InChI=1S/C14H18O2/c15-12-10-14(8-4-1-5-9-14)16-13-7-3-2-6-11(12)13/h2-3,6-7,12,15H,1,4-5,8-10H2/t12-/m0/s1 |
| InChIKey | RYXHBYZYHRDWSN-LBPRGKRZSA-N |
| XLogP | 3.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |