C18H24O2 — CID 104978954
CID 104978954 (PubChem CID 104978954) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol.
| Compound Name | CID 104978954 |
|---|---|
| PubChem CID | 104978954 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | — |
| SMILES | O[C@H]1CC2(CCC3(CCCC3)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C18H24O2/c19-15-13-18(20-16-6-2-1-5-14(15)16)11-9-17(10-12-18)7-3-4-8-17/h1-2,5-6,15,19H,3-4,7-13H2/t15-/m0/s1 |
| InChIKey | XSWCIYFCFCTZCH-HNNXBMFYSA-N |
| XLogP | 4.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |