C18H26O2 — CID 104949941
(4S)-4'-propylspiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol (PubChem CID 104949941) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (4S)-4'-propylspiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol.
| Compound Name | (4S)-4'-propylspiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol |
|---|---|
| PubChem CID | 104949941 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (4S)-4'-propylspiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol |
| SMILES | CCCC1CCCC2(CC1)C[C@H](O)c1ccccc1O2 |
| InChI | InChI=1S/C18H26O2/c1-2-6-14-7-5-11-18(12-10-14)13-16(19)15-8-3-4-9-17(15)20-18/h3-4,8-9,14,16,19H,2,5-7,10-13H2,1H3/t14?,16-,18?/m0/s1 |
| InChIKey | BBMRRRQYXOHGJQ-HQVVEAJESA-N |
| XLogP | 4.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |