C19H28O2 — CID 104950101
(4R)-4'-tert-butylspiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol (PubChem CID 104950101) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (4R)-4'-tert-butylspiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol.
| Compound Name | (4R)-4'-tert-butylspiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol |
|---|---|
| PubChem CID | 104950101 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (4R)-4'-tert-butylspiro[3,4-dihydrochromene-2,1'-cycloheptane]-4-ol |
| SMILES | CC(C)(C)C1CCCC2(CC1)C[C@@H](O)c1ccccc1O2 |
| InChI | InChI=1S/C19H28O2/c1-18(2,3)14-7-6-11-19(12-10-14)13-16(20)15-8-4-5-9-17(15)21-19/h4-5,8-9,14,16,20H,6-7,10-13H2,1-3H3/t14?,16-,19?/m1/s1 |
| InChIKey | DMBKERIBVIITAO-NLGTXKQRSA-N |
| XLogP | 4.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |