About (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol
(4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol (PubChem CID 104950092) has the molecular formula C13H16O2S
and a molecular weight of 236.34 g/mol. Its IUPAC name is (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol.
Molecular Properties
| Compound Name | (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol |
| PubChem CID | 104950092 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol |
| SMILES | O[C@@H]1CC2(CCCSC2)Oc2ccccc21 |
| InChI | InChI=1S/C13H16O2S/c14-11-8-13(6-3-7-16-9-13)15-12-5-2-1-4-10(11)12/h1-2,4-5,11,14H,3,6-9H2/t11-,13?/m1/s1 |
| InChIKey | UZNWIHQOCHCKBU-JTDNENJMSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol?
The IUPAC name of (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol (CID 104950092) is (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol.
What is the SMILES notation for (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol?
The canonical SMILES for (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol is O[C@@H]1CC2(CCCSC2)Oc2ccccc21.
What is the InChIKey of (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol?
The InChIKey is UZNWIHQOCHCKBU-JTDNENJMSA-N. The full InChI is InChI=1S/C13H16O2S/c14-11-8-13(6-3-7-16-9-13)15-12-5-2-1-4-10(11)12/h1-2,4-5,11,14H,3,6-9H2/t11-,13?/m1/s1.
What are the key properties of (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol?
(4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol has a molecular weight of 236.34 g/mol, XLogP of 2.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-spiro[3,4-dihydrochromene-2,3'-thiane]-4-ol is sourced from PubChem (CID 104950092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).