C14H19NO2S — CID 114709853
6-methoxyspiro[3,4-dihydrochromene-2,3'-thiane]-4-amine (PubChem CID 114709853) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 6-methoxyspiro[3,4-dihydrochromene-2,3'-thiane]-4-amine.
| Compound Name | 6-methoxyspiro[3,4-dihydrochromene-2,3'-thiane]-4-amine |
|---|---|
| PubChem CID | 114709853 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 6-methoxyspiro[3,4-dihydrochromene-2,3'-thiane]-4-amine |
| SMILES | COc1ccc2c(c1)C(N)CC1(CCCSC1)O2 |
| InChI | InChI=1S/C14H19NO2S/c1-16-10-3-4-13-11(7-10)12(15)8-14(17-13)5-2-6-18-9-14/h3-4,7,12H,2,5-6,8-9,15H2,1H3 |
| InChIKey | MBYOWRNDBTZKIS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |