C12H14BrNOS — CID 104947217
(4S)-6-bromospiro[3,4-dihydrochromene-2,3'-thiolane]-4-amine (PubChem CID 104947217) has the molecular formula C12H14BrNOS and a molecular weight of 300.22 g/mol. Its IUPAC name is (4S)-6-bromospiro[3,4-dihydrochromene-2,3'-thiolane]-4-amine.
| Compound Name | (4S)-6-bromospiro[3,4-dihydrochromene-2,3'-thiolane]-4-amine |
|---|---|
| PubChem CID | 104947217 |
| Molecular Formula | C12H14BrNOS |
| Molecular Weight | 300.22 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | (4S)-6-bromospiro[3,4-dihydrochromene-2,3'-thiolane]-4-amine |
| SMILES | N[C@H]1CC2(CCSC2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C12H14BrNOS/c13-8-1-2-11-9(5-8)10(14)6-12(15-11)3-4-16-7-12/h1-2,5,10H,3-4,6-7,14H2/t10-,12?/m0/s1 |
| InChIKey | XDLRVYPQUKEXMM-NUHJPDEHSA-N |
| XLogP | 3.11 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |