C16H23NO2 — CID 42130108
(4S)-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine (PubChem CID 42130108) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is (4S)-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine.
| Compound Name | (4S)-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
|---|---|
| PubChem CID | 42130108 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (4S)-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclohexane]-4-amine |
| SMILES | CCOc1ccc2c(c1)[C@@H](N)CC1(CCCCC1)O2 |
| InChI | InChI=1S/C16H23NO2/c1-2-18-12-6-7-15-13(10-12)14(17)11-16(19-15)8-4-3-5-9-16/h6-7,10,14H,2-5,8-9,11,17H2,1H3/t14-/m0/s1 |
| InChIKey | OVUFIMIPKUQGFC-AWEZNQCLSA-N |
| XLogP | 3.57 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |