About 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol
3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol (PubChem CID 82020729) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol.
Molecular Properties
| Compound Name | 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol |
| PubChem CID | 82020729 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol |
| SMILES | CCOc1ccc2c(c1)C(O)C(N)C1(CCCC1)O2 |
| InChI | InChI=1S/C15H21NO3/c1-2-18-10-5-6-12-11(9-10)13(17)14(16)15(19-12)7-3-4-8-15/h5-6,9,13-14,17H,2-4,7-8,16H2,1H3 |
| InChIKey | HTLXFKAHQROBKK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol?
The IUPAC name of 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol (CID 82020729) is 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol.
What is the SMILES notation for 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol?
The canonical SMILES for 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol is CCOc1ccc2c(c1)C(O)C(N)C1(CCCC1)O2.
What is the InChIKey of 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol?
The InChIKey is HTLXFKAHQROBKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-2-18-10-5-6-12-11(9-10)13(17)14(16)15(19-12)7-3-4-8-15/h5-6,9,13-14,17H,2-4,7-8,16H2,1H3.
What are the key properties of 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol?
3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol has a molecular weight of 263.34 g/mol, XLogP of 2.15, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-ethoxyspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol is sourced from PubChem (CID 82020729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).