C11H15NO2 — CID 12051572
(1R,2R)-2-amino-6-ethoxy-2,3-dihydro-1H-inden-1-ol (PubChem CID 12051572) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (1R,2R)-2-amino-6-ethoxy-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R,2R)-2-amino-6-ethoxy-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 12051572 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (1R,2R)-2-amino-6-ethoxy-2,3-dihydro-1H-inden-1-ol |
| SMILES | CCOc1ccc2c(c1)[C@@H](O)[C@H](N)C2 |
| InChI | InChI=1S/C11H15NO2/c1-2-14-8-4-3-7-5-10(12)11(13)9(7)6-8/h3-4,6,10-11,13H,2,5,12H2,1H3/t10-,11-/m1/s1 |
| InChIKey | ALANTHSNAAHVHE-GHMZBOCLSA-N |
| XLogP | 1.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |