C13H18O2S — CID 82885777
7-ethoxy-3-methyl-1,3,4,5-tetrahydro-2-benzothiepin-5-ol (PubChem CID 82885777) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 7-ethoxy-3-methyl-1,3,4,5-tetrahydro-2-benzothiepin-5-ol.
| Compound Name | 7-ethoxy-3-methyl-1,3,4,5-tetrahydro-2-benzothiepin-5-ol |
|---|---|
| PubChem CID | 82885777 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 7-ethoxy-3-methyl-1,3,4,5-tetrahydro-2-benzothiepin-5-ol |
| SMILES | CCOc1ccc2c(c1)C(O)CC(C)SC2 |
| InChI | InChI=1S/C13H18O2S/c1-3-15-11-5-4-10-8-16-9(2)6-13(14)12(10)7-11/h4-5,7,9,13-14H,3,6,8H2,1-2H3 |
| InChIKey | WMRNXFOWEXRTEC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |