C14H21NO2 — CID 70672105
5-ethoxy-2-hydroxy-1,1,3,3-tetramethylisoindole (PubChem CID 70672105) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 5-ethoxy-2-hydroxy-1,1,3,3-tetramethylisoindole.
| Compound Name | 5-ethoxy-2-hydroxy-1,1,3,3-tetramethylisoindole |
|---|---|
| PubChem CID | 70672105 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 5-ethoxy-2-hydroxy-1,1,3,3-tetramethylisoindole |
| SMILES | CCOc1ccc2c(c1)C(C)(C)N(O)C2(C)C |
| InChI | InChI=1S/C14H21NO2/c1-6-17-10-7-8-11-12(9-10)14(4,5)15(16)13(11,2)3/h7-9,16H,6H2,1-5H3 |
| InChIKey | FMCHUSDGTHHIFQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |