C15H23NO — CID 79837369
6-ethoxy-N-ethyl-3,3-dimethyl-1,2-dihydroinden-1-amine (PubChem CID 79837369) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 6-ethoxy-N-ethyl-3,3-dimethyl-1,2-dihydroinden-1-amine.
| Compound Name | 6-ethoxy-N-ethyl-3,3-dimethyl-1,2-dihydroinden-1-amine |
|---|---|
| PubChem CID | 79837369 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 6-ethoxy-N-ethyl-3,3-dimethyl-1,2-dihydroinden-1-amine |
| SMILES | CCNC1CC(C)(C)c2ccc(OCC)cc21 |
| InChI | InChI=1S/C15H23NO/c1-5-16-14-10-15(3,4)13-8-7-11(17-6-2)9-12(13)14/h7-9,14,16H,5-6,10H2,1-4H3 |
| InChIKey | JWRIFEJXBYOPAT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |