About N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine
N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine (PubChem CID 82462320) has the molecular formula C18H29NO2
and a molecular weight of 291.44 g/mol. Its IUPAC name is N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine |
| PubChem CID | 82462320 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine |
| SMILES | CCNC1CC(C)(CC)Oc2cc(OCC(C)C)ccc21 |
| InChI | InChI=1S/C18H29NO2/c1-6-18(5)11-16(19-7-2)15-9-8-14(10-17(15)21-18)20-12-13(3)4/h8-10,13,16,19H,6-7,11-12H2,1-5H3 |
| InChIKey | LKIAMPREONCHNQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine?
The IUPAC name of N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine (CID 82462320) is N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine.
What is the SMILES notation for N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine?
The canonical SMILES for N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine is CCNC1CC(C)(CC)Oc2cc(OCC(C)C)ccc21.
What is the InChIKey of N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine?
The InChIKey is LKIAMPREONCHNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29NO2/c1-6-18(5)11-16(19-7-2)15-9-8-14(10-17(15)21-18)20-12-13(3)4/h8-10,13,16,19H,6-7,11-12H2,1-5H3.
What are the key properties of N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine?
N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine has a molecular weight of 291.44 g/mol, XLogP of 4.32, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-diethyl-2-methyl-7-(2-methylpropoxy)-3,4-dihydrochromen-4-amine is sourced from PubChem (CID 82462320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).