C18H29NO2 — CID 82462351
6-butoxy-N,2-diethyl-2-methyl-3,4-dihydrochromen-4-amine (PubChem CID 82462351) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 6-butoxy-N,2-diethyl-2-methyl-3,4-dihydrochromen-4-amine.
| Compound Name | 6-butoxy-N,2-diethyl-2-methyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 82462351 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 6-butoxy-N,2-diethyl-2-methyl-3,4-dihydrochromen-4-amine |
| SMILES | CCCCOc1ccc2c(c1)C(NCC)CC(C)(CC)O2 |
| InChI | InChI=1S/C18H29NO2/c1-5-8-11-20-14-9-10-17-15(12-14)16(19-7-3)13-18(4,6-2)21-17/h9-10,12,16,19H,5-8,11,13H2,1-4H3 |
| InChIKey | NLKZSZGHQAIEMB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|